CAS 130269-18-0
:3-Thiopheneacetic acid, methyl ester, homopolymer
Description:
3-Thiopheneacetic acid, methyl ester, homopolymer is a synthetic polymer derived from the polymerization of 3-thiopheneacetic acid methyl ester. This compound features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties and potential applications in organic electronics and materials science. The polymerization of this ester results in a homopolymer characterized by a repeating unit that retains the thiophene structure, enhancing its stability and solubility in organic solvents. The presence of the methyl ester group can influence the polymer's physical properties, such as its melting point, glass transition temperature, and mechanical strength. Additionally, the thiophene moiety can facilitate interactions with other materials, making it suitable for applications in conductive films, sensors, and drug delivery systems. Overall, this polymer exhibits interesting characteristics that can be tailored for specific applications in advanced materials and nanotechnology.
Formula:(C7H8O2S)x
InChI:InChI=1S/C7H8O2S/c1-9-7(8)4-6-2-3-10-5-6/h2-3,5H,4H2,1H3
InChI key:InChIKey=RZGRWVULDSXQSM-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C=1C=CSC1
Synonyms:- Methyl 3-thienylacetate homopolymer
- Methyl 3-thiopheneacetate homopolymer
- 3-Thiophene methyl acetate homopolymer
- Poly(methyl 3-thiopheneacetate)
- 3-Thiopheneacetic acid, methyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
