CAS 13028-73-4
:1-Octanaminium, N,N,N-triethyl-, bromide (1:1)
Description:
1-Octanaminium, N,N,N-triethyl-, bromide (1:1), with CAS number 13028-73-4, is a quaternary ammonium compound characterized by its long hydrophobic octyl chain and three ethyl groups attached to the nitrogen atom. This structure imparts both hydrophilic and hydrophobic properties, making it a surfactant and a potential emulsifying agent. The bromide ion serves as the counterion, contributing to the compound's solubility in polar solvents. Typically, quaternary ammonium compounds exhibit antimicrobial properties, making them useful in various applications, including disinfectants and preservatives. The presence of the long alkyl chain enhances its ability to interact with biological membranes, which can influence its efficacy in biological systems. Additionally, this compound may exhibit phase behavior that is dependent on temperature and concentration, affecting its utility in formulations. Overall, 1-Octanaminium, N,N,N-triethyl-, bromide is significant in both industrial and research contexts due to its unique physicochemical properties.
Formula:C14H32N·Br
InChI:InChI=1S/C14H32N.BrH/c1-5-9-10-11-12-13-14-15(6-2,7-3)8-4;/h5-14H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=FASLCARXKMYXDH-UHFFFAOYSA-M
SMILES:[N+](CCCCCCCC)(CC)(CC)CC.[Br-]
Synonyms:- Ammonium, triethyloctyl-, bromide
- Octyltriethylammonium bromide
- Triethyloctylammonium bromide
- 1-Octanaminium, N,N,N-triethyl-, bromide (1:1)
- 1-Octanaminium, N,N,N-triethyl-, bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
