CAS 130284-52-5

5-Amino-2-bromo-3-chloropyridine

Description:

5-Amino-2-bromo-3-chloropyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an amino group, a bromine atom, and a chlorine atom. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The amino group (-NH2) enhances its nucleophilicity, making it a valuable intermediate in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries. The bromine and chlorine substituents introduce additional reactivity, allowing for further functionalization through electrophilic aromatic substitution or cross-coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and specific conditions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures are necessary. Overall, 5-Amino-2-bromo-3-chloropyridine is a versatile compound with significant applications in synthetic chemistry.

Formula: C₅H₄BrClN₂

InChI: InChI=1/C5H4BrClN2/c6-5-4(7)1-3(8)2-9-5/h1-2H,8H2

SMILES: c1c(cnc(c1Cl)Br)N

Synonyms:

• 2-Bromo-3-Chloro-5-Aminopyridine
• 3-Amino-6-bromo-5-chloropyridine

3-Pyridinamine, 6-bromo-5-chloro-

CAS: 130284-52-5

Formula: C₅H₄BrClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 207.4557

Ref: IN-DA000U84

6-Bromo-5-chloropyridin-3-amine

CAS: 130284-52-5

6-Bromo-5-chloropyridin-3-amine

Purity: 98%

Molecular weight: 207.46g/mol

Ref: 54-OR315087

6-Bromo-5-chloropyridin-3-amine

CAS: 130284-52-5

Formula: C₅H₄BrClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 207.46

Ref: 10-F223921