CAS 130288-24-3
:Duocarmycin SA
Description:
Duocarmycin SA is a potent antitumor agent belonging to the class of DNA alkylating compounds. It is derived from the natural product duocarmycin, which is known for its ability to bind to DNA and induce cytotoxic effects, primarily through the formation of covalent bonds with the DNA bases. This mechanism disrupts the normal function of DNA, leading to cell cycle arrest and apoptosis in rapidly dividing cancer cells. Duocarmycin SA exhibits high selectivity for tumor cells, making it a candidate for targeted cancer therapies. The compound is characterized by its complex structure, which includes a bicyclic core that contributes to its biological activity. Additionally, it is typically administered in a controlled manner due to its potent effects and potential side effects. Research continues to explore its efficacy and safety profiles, as well as its potential use in combination therapies to enhance anticancer effects while minimizing toxicity to normal tissues.
Formula:C25H23N3O7
InChI:InChI=1/C25H23N3O7/c1-32-17-6-11-5-14(26-19(11)22(34-3)21(17)33-2)23(30)28-10-12-9-25(12)13-7-15(24(31)35-4)27-20(13)16(29)8-18(25)28/h5-8,12,26-27H,9-10H2,1-4H3/t12-,25-/m1/s1
InChI key:InChIKey=VQNATVDKACXKTF-XELLLNAOSA-N
SMILES:C(=O)(N1C=2[C@]3([C@](C3)(C1)[H])C4=C(NC(C(OC)=O)=C4)C(=O)C2)C=5NC=6C(C5)=CC(OC)=C(OC)C6OC
Synonyms:- Antibiotic DC 113
- Cyclopropa[c]pyrrolo[3,2-e]indole-6-carboxylic acid, 1,2,4,5,8,8a-hexahydro-4-oxo-2-[(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl]-, methyl ester, (7bR)-
- Cyclopropa[c]pyrrolo[3,2-e]indole-6-carboxylic acid, 1,2,4,5,8,8a-hexahydro-4-oxo-2-[(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl]-, methyl ester, (7bR,8aS)-
- Cyclopropacpyrrolo3,2-eindole-6-carboxylic acid, 1,2,4,5,8,8a-hexahydro-4-oxo-2-(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl-, methyl ester, (7bR)-
- methyl (3bR,4aS)-8-oxo-6-[(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl]-1,4,4a,5,6,8-hexahydrocyclopropa[c]pyrrolo[3,2-e]indole-2-carboxylate
- (+)-Duocarmycin SA
- Duocarmycin SA
- Cyclopropa[c]pyrrolo[3,2-e]indole-6-carboxylicacid,1,2,4,5,8,8a-hexahydro-4-oxo-2-[(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl]-,methyl ester, (7bR,8aS)-
- CS-1375
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Duocarmycin SA
CAS:Duocarmycin SA: potent cytotoxic, antitumor antibiotic; induces DNA alkylation; IC50 of 10 pM; enhances proton radiation against GBM cells.
Formula:C25H23N3O7Purity:98%Color and Shape:SolidMolecular weight:477.47Duocarmycin sa
CAS:Duocarmycin SA is an antitumor antibiotic, which is derived from the natural products of Streptomyces bacteria. This compound exhibits its mode of action through the alkylation of DNA, specifically binding within the minor groove. The alkylation process preferentially targets adenine-thymine-rich regions, leading to irreversible DNA damage and subsequent inhibition of DNA replication. Such interaction results in the induction of apoptosis in rapidly dividing cells.
Formula:C25H23N3O7Purity:Min. 95%Molecular weight:477.5 g/mol


