CAS 13030-09-6
:H-Glu-OBzl
Description:
H-Glu-OBzl, also known as benzyl ester of glutamic acid, is a chemical compound characterized by its structure, which includes a glutamic acid moiety with a benzyl group attached to the carboxyl group. This compound is typically used in peptide synthesis and as a building block in organic chemistry due to its ability to participate in various reactions, including esterification and amidation. The presence of the benzyl group enhances its lipophilicity, making it more soluble in organic solvents compared to its parent amino acid. H-Glu-OBzl can also serve as a protecting group for the carboxylic acid functionality during peptide synthesis, allowing for selective reactions at other functional groups. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used. As with many amino acid derivatives, it is important to handle H-Glu-OBzl with care, following appropriate safety protocols, as it may exhibit biological activity or interact with other compounds in a laboratory setting.
Formula:C12H15NO4
InChI:InChI=1/C12H15NO4/c13-10(6-7-11(14)15)12(16)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,14,15)/t10-/m0/s1
SMILES:c1ccc(cc1)COC(=O)[C@H](CCC(=O)O)N
Synonyms:- L-Glu-a-O-Bzl
- Glu.OBzl
- (4S)-4-ammonio-5-(benzyloxy)-5-oxopentanoate
- L-Glutamic Acid Alpha-Benzyl Ester
- H-Glu-OBzl・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Benzyl L-Glutamate
CAS:Formula:C12H15NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:237.26H-Glu-OBzl
CAS:<p>Bachem ID: 4000337.</p>Formula:C12H15NO4Purity:99.9%Color and Shape:Light YellowMolecular weight:237.26L-Glutamic acid, 1-(phenylmethyl) ester
CAS:Formula:C12H15NO4Purity:97%Color and Shape:SolidMolecular weight:237.2518L-Glutamic Acid α-Benzyl Ester
CAS:L-Glutamic Acid α-Benzyl EsterPurity:98%Molecular weight:237.25g/mol
