
CAS 13030-22-3
:3-(2,5-Dimethylphenoxy)-1-propanol
Description:
3-(2,5-Dimethylphenoxy)-1-propanol, identified by its CAS number 13030-22-3, is an organic compound characterized by its structure, which includes a propanol backbone and a 2,5-dimethylphenoxy group. This compound typically exhibits properties associated with alcohols, such as being a colorless to pale yellow liquid with a moderate boiling point and solubility in organic solvents. Its molecular structure suggests it may have applications in various fields, including pharmaceuticals and agrochemicals, due to the presence of the phenoxy group, which can enhance biological activity. The compound may also demonstrate moderate to low toxicity, but specific safety data should be consulted for handling and usage. Additionally, its chemical reactivity can be influenced by the presence of functional groups, making it a potential candidate for further chemical modifications or synthesis of derivatives. Overall, 3-(2,5-Dimethylphenoxy)-1-propanol is a versatile compound with potential applications in chemical synthesis and industrial processes.
Formula:C11H16O2
InChI:InChI=1S/C11H16O2/c1-9-4-5-10(2)11(8-9)13-7-3-6-12/h4-5,8,12H,3,6-7H2,1-2H3
InChI key:InChIKey=OXEFBHPIEHPRES-UHFFFAOYSA-N
SMILES:O(CCCO)C1=C(C)C=CC(C)=C1
Synonyms:- 1-Propanol, 3-(2,5-xylyloxy)-
- 1-Propanol, 3-(2,5-dimethylphenoxy)-
- 3-(2,5-Dimethylphenoxy)-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.