
CAS 13030-63-2
:11-Bromo-10-undecynoic acid
Description:
11-Bromo-10-undecynoic acid is an organic compound characterized by its unique structure, which includes a long carbon chain and a terminal alkyne functional group. This compound features a bromine atom at the 11th position and a carboxylic acid group at the end of the undecynoic chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the alkyne group allows for various chemical transformations, making it useful in the synthesis of more complex molecules. Additionally, the bromine substituent can serve as a site for nucleophilic substitution reactions. This compound is typically used in research settings, particularly in the fields of medicinal chemistry and materials science, where it may be involved in the development of new pharmaceuticals or functional materials. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling 11-bromo-10-undecynoic acid due to its potential hazards.
Formula:C11H17BrO2
InChI:InChI=1S/C11H17BrO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-7,9H2,(H,13,14)
InChI key:InChIKey=QLHALQHHPFSYOE-UHFFFAOYSA-N
SMILES:C(CCCCCC#CBr)CCC(O)=O
Synonyms:- 11-Bromo-10-undecynoic acid
- 10-Undecynoic acid, 11-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
