CAS 130307-09-4

[4-(4-Methyl-1-piperazinyl)phenyl]lithium

Description:

[4-(4-Methyl-1-piperazinyl)phenyl]lithium, with CAS number 130307-09-4, is an organolithium compound characterized by the presence of a lithium atom bonded to a phenyl group that is substituted with a piperazine moiety. This compound typically exhibits high reactivity due to the presence of the lithium atom, which can act as a strong nucleophile. The piperazine ring contributes to the compound's solubility in various organic solvents and may influence its reactivity and stability. Organolithium compounds are often used as strong bases and nucleophiles in organic synthesis, facilitating the formation of carbon-carbon bonds. The presence of the methyl group on the piperazine can enhance steric effects and potentially influence the compound's reactivity. Additionally, due to the nature of organolithium compounds, [4-(4-Methyl-1-piperazinyl)phenyl]lithium must be handled with care, as it can react violently with moisture and air, necessitating storage under inert atmospheres. Overall, this compound is of interest in synthetic organic chemistry for its unique properties and potential applications.

Formula: C₁₁H₁₅LiN₂

InChI: InChI=1S/C11H15N2.Li/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11;/h3-6H,7-10H2,1H3;

InChI key: InChIKey=IVOMBPVAMQIVEV-UHFFFAOYSA-N

SMILES: [Li]C1=CC=C(C=C1)N2CCN(C)CC2

Synonyms:

• Piperazine, 1-methyl-4-phenyl-, lithium complex
• 4-(4-Methylpiperazino)phenyllithium
• Lithium, [4-(4-methyl-1-piperazinyl)phenyl]-
• [4-(4-Methyl-1-piperazinyl)phenyl]lithium

Lithium, [4-(4-methyl-1-piperazinyl)phenyl]-

CAS: 130307-09-4

Formula: C₁₁H₁₅LiN₂

Molecular weight: 182.1912

Ref: IN-DA000U9D