CAS 130332-59-1

4-Amino-5-formylamino-3-isobutyl-1-methylpyrimidine-2,6-dione

Description:

4-Amino-5-formylamino-3-isobutyl-1-methylpyrimidine-2,6-dione, with the CAS number 130332-59-1, is a pyrimidine derivative characterized by its complex structure that includes amino, formylamino, and isobutyl functional groups. This compound typically exhibits properties associated with heterocyclic compounds, such as potential solubility in polar solvents due to the presence of amino groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. The presence of multiple functional groups suggests it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl and isobutyl groups contribute to its steric properties, potentially influencing its interaction with biological targets. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₆N₄O₃

InChI: InChI=1/C10H16N4O3/c1-6(2)4-14-8(11)7(12-5-15)9(16)13(3)10(14)17/h5-6H,4,11H2,1-3H3,(H,12,15)

SMILES: CC(C)Cn1c(c(c(=O)n(C)c1=O)N=CO)N

Synonyms:

• N-[6-Amino-1,2,3,4-tetrahydro-3-methyl-1-(2-methylpropyl)-2,4-dioxo-5-pyrimidinyl]- formamide
• N-[6-amino-3-methyl-1-(2-methylpropyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl]formamide

4-Amino-5-formylamino-3-isobutyl-1-methylpyrimidine-2,6-dione

Controlled Product

CAS: 130332-59-1

Formula: C₁₀H₁₆N₄O₃

Color and Shape: Neat

Molecular weight: 240.26

Ref: TR-A609650