CymitQuimica logo

CAS 1303470-48-5

:

KHK-IN-1 (hydrochloride)

Description:
KHK-IN-1 (hydrochloride), with the CAS number 1303470-48-5, is a small molecule inhibitor primarily studied for its potential therapeutic applications in oncology. It is characterized by its ability to selectively inhibit certain protein targets involved in cancer cell proliferation and survival. The hydrochloride salt form enhances its solubility and stability, making it more suitable for pharmaceutical formulations. KHK-IN-1 exhibits a specific mechanism of action that disrupts signaling pathways critical for tumor growth, which is a focus of ongoing research. Its chemical structure typically includes functional groups that facilitate binding to target proteins, contributing to its efficacy. Additionally, studies may explore its pharmacokinetics, toxicity profile, and potential side effects, which are crucial for determining its viability as a treatment option. As with many investigational compounds, further clinical trials are necessary to fully understand its therapeutic potential and safety in humans.
Formula:C21H27ClN8S
InChI:InChI=1S/C21H26N8S.ClH/c1-30-16-5-3-2-4-15(16)26-20-17-18(19(25-13-24-17)23-12-14-6-7-14)27-21(28-20)29-10-8-22-9-11-29;/h2-5,13-14,22H,6-12H2,1H3,(H,23,24,25)(H,26,27,28);1H
InChI key:VKIBPWKARAEIHN-UHFFFAOYSA-N
SMILES:CSC1=CC=CC=C1NC2=NC(=NC3=C2N=CN=C3NCC4CC4)N5CCNCC5.Cl
Synonyms:
  • KHK inhibitor 1 hydrochloride
  • (Ketohexokinase inhibitor 8)
  • KHK-IN-1 (hydrochloride)
  • KHK-IN-8 hydrochloride
Found 5 products.