
CAS 1303587-94-1
:6-Bromo-3,4-dihydro-8-methyl-2H-pyrido[3,2-b]-1,4-oxazine
Description:
6-Bromo-3,4-dihydro-8-methyl-2H-pyrido[3,2-b]-1,4-oxazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and an oxazine ring. The presence of a bromine atom at the 6-position and a methyl group at the 8-position contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties typical of nitrogen-containing heterocycles, such as the ability to participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Its dihydro form suggests that it may have reduced aromaticity compared to fully aromatic counterparts, which can influence its stability and reactivity. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. The specific characteristics, such as solubility, melting point, and spectral properties, would depend on the compound's purity and the conditions under which it is studied. Overall, 6-Bromo-3,4-dihydro-8-methyl-2H-pyrido[3,2-b]-1,4-oxazine represents a class of compounds with potential applications in pharmaceuticals and materials science.
Formula:C8H9BrN2O
InChI:InChI=1S/C8H9BrN2O/c1-5-4-6(9)11-8-7(5)12-3-2-10-8/h4H,2-3H2,1H3,(H,10,11)
InChI key:InChIKey=QQZUZFFPEHJRPO-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC(Br)=C1)NCCO2
Synonyms:- 6-Bromo-3,4-dihydro-8-methyl-2H-pyrido[3,2-b]-1,4-oxazine
- 2H-Pyrido[3,2-b]-1,4-oxazine, 6-bromo-3,4-dihydro-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.