
CAS 13036-41-4
:N-(Ethoxymethyl)-2-propenamide
Description:
N-(Ethoxymethyl)-2-propenamide, with the CAS number 13036-41-4, is an organic compound characterized by its amide functional group and an ethoxymethyl substituent attached to a propenamide backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for many amides, and may exhibit moderate stability under standard conditions. The presence of the ethoxymethyl group can influence its reactivity, making it potentially useful in various chemical reactions, including polymerization processes. Additionally, the propenamide structure suggests that it may participate in Michael addition reactions or serve as a monomer in the synthesis of polymers. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage and compliance with regulatory standards. Overall, N-(Ethoxymethyl)-2-propenamide is of interest in both academic and industrial chemistry for its potential applications.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-3-6(8)7-5-9-4-2/h3H,1,4-5H2,2H3,(H,7,8)
InChI key:InChIKey=LSWADWIFYOAQRZ-UHFFFAOYSA-N
SMILES:C(NCOCC)(C=C)=O
Synonyms:- Acrylamide, N-(ethoxymethyl)-
- N-(Ethoxymethyl)acrylamide
- N-(Ethoxymethyl)-2-propenamide
- 2-Propenamide, N-(ethoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
