
CAS 13036-83-4
:1,3,5-Tributylhexahydro-1,3,5-triazine
Description:
1,3,5-Tributylhexahydro-1,3,5-triazine, with the CAS number 13036-83-4, is a cyclic organic compound characterized by its triazine ring structure, which is fully saturated with hydrogen atoms. This compound features three butyl groups attached to the triazine ring, contributing to its hydrophobic nature and influencing its solubility properties. Typically, it appears as a colorless to pale yellow liquid and has a relatively low volatility. The presence of the triazine moiety suggests potential applications in various fields, including agriculture as a herbicide or in the synthesis of other chemical compounds. Its chemical stability and resistance to degradation make it suitable for use in formulations requiring long-lasting effects. However, like many organic compounds, it should be handled with care, considering potential environmental and health impacts. Overall, 1,3,5-Tributylhexahydro-1,3,5-triazine is notable for its unique structure and potential utility in chemical applications.
Formula:C15H33N3
InChI:InChI=1S/C15H33N3/c1-4-7-10-16-13-17(11-8-5-2)15-18(14-16)12-9-6-3/h4-15H2,1-3H3
InChI key:InChIKey=OIQDTXAPPNRLAS-UHFFFAOYSA-N
SMILES:C(CCC)N1CN(CCCC)CN(CCCC)C1
Synonyms:- s-Triazine, 1,3,5-tributylhexahydro-
- 1,3,5-Tributylhexahydro-s-triazine
- 1,3,5-Tributyl-1,3,5-triazinane
- 1,3,5-Tributylhexahydro-1,3,5-triazine
- 1,3,5-Triazine, 1,3,5-tributylhexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
