CAS 130369-06-1: (3-aminocyclobutyl)methanol hydrochloride

Description:(3-Aminocyclobutyl)methanol hydrochloride is a chemical compound characterized by its unique structure, which includes a cyclobutane ring with an amino group and a hydroxymethyl group. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt, which enhances its solubility and stability. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its functional groups. Additionally, the presence of the hydrochloride form indicates that it can be used in various formulations, enhancing its bioavailability. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.

Formula:C₅H₁₂ClNO

InChI:InChI=1/C5H11NO.ClH/c6-5-1-4(2-5)3-7;/h4-5,7H,1-3,6H2;1H

Synonyms:
(3-Aminocyclobutyl)methanol hydrochloride (1:1)
Cyclobutanemethanol, 3-Amino-, Hydrochloride (1:1)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Cyclobutanemethanol, 3-amino-, hydrochloride (1:1) REF: IN-DA000UBDCAS: 130369-06-1	95%	117.00 €~625.00 €	Tue 15 Apr 25
(3-Aminocyclobutyl)methanol hydrochloride REF: 54-OR308092CAS: 130369-06-1	- - -	To inquire	Tue 22 Apr 25
(3-Aminocyclobutyl)methanol hydrochloride REF: 10-F602820CAS: 130369-06-1	98%	- - -	Discontinued product
(3-Aminocyclobutyl)methanol hydrochloride REF: 3D-FFA36906CAS: 130369-06-1	Min. 95%	- - -	Discontinued product