CAS 13037-05-3

Pyridyldithiocarbamicacidethylester; 98%

Description:

Pyridyldithiocarbamic acid ethyl ester, with the CAS number 13037-05-3, is a chemical compound characterized by its dithiocarbamate structure, which includes a pyridine ring. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific formulation. It is known for its applications in various fields, including agriculture as a fungicide and in organic synthesis as a reagent. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Pyridyldithiocarbamic acid ethyl ester exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. Its reactivity is influenced by the dithiocarbamate functional group, which can participate in nucleophilic substitution reactions. Additionally, it may exhibit antimicrobial properties, contributing to its utility in crop protection. As with many chemical substances, proper storage and handling are essential to maintain its stability and effectiveness.

Formula: C₈H₁₀N₂S₂

InChI: InChI=1/C8H10N2S2/c1-2-12-8(11)10-7-5-3-4-6-9-7/h3-6H,2H2,1H3,(H,9,10,11)

SMILES: CCSC(=Nc1ccccn1)S

Synonyms:

• 2-Pyridyldithiocarbamic acid ethyl ester
• Ethyl Pyridin-2-Ylcarbamodithioate

2-Pyridyldithiocarbamic acid ethyl ester

CAS: 13037-05-3

Formula: C₈H₁₀N₂S₂

Purity: >98.0%(T)

Color and Shape: Solid

Molecular weight: 198.3084

Ref: IN-DA000UBW

Ethyl pyridin-2-ylcarbamodithioate

CAS: 13037-05-3

Purity: 98%

Molecular weight: 198.3000031

Ref: 10-F768245