CAS 130370-02-4: N,N,2-trimethyl-5-nitrobenzamide

Description:N,N,2-trimethyl-5-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a nitro group and an amide functional group. The presence of the nitro group (-NO2) at the 5-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions, including nitration and reduction processes. The trimethyl substituents at the nitrogen atom enhance the steric hindrance, which can influence the compound's solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate to low solubility in polar solvents due to its hydrophobic aromatic structure. Its chemical properties make it of interest in fields such as pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock, and may pose environmental hazards.

Formula:C₁₀H₁₂N₂O₃

InChI:InChI=1/C10H12N2O3/c1-7-4-5-8(12(14)15)6-9(7)10(13)11(2)3/h4-6H,1-3H3