CAS 13038-47-6
:methyl (9E,11E)-octadeca-9,11-dienoate
Description:
Methyl (9E,11E)-octadeca-9,11-dienoate, commonly known as methyl linoleate, is an unsaturated fatty acid ester characterized by its long hydrocarbon chain and two double bonds located at the 9th and 11th carbon positions. This compound is a colorless to pale yellow liquid at room temperature and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. It is primarily derived from natural sources, particularly vegetable oils, and is often used in the food industry as a flavoring agent or emulsifier. Additionally, methyl linoleate has applications in the cosmetic and pharmaceutical industries due to its potential health benefits, including anti-inflammatory properties. Its molecular structure contributes to its reactivity, making it susceptible to oxidation, which can affect its stability and shelf life. Overall, methyl (9E,11E)-octadeca-9,11-dienoate is an important compound in various industrial applications, reflecting its versatility and significance in both food and health-related fields.
Formula:C19H34O2
InChI:InChI=1/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h8-11H,3-7,12-18H2,1-2H3/b9-8+,11-10+
Synonyms:- 9,11-octadecadienoic acid, methyl ester, (9E,11E)-
- 9,11-Octadecadienoic acid, methyl ester, (E,E)-
- Methyl 9,11-Octadecadienoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 9(E),11(E)-Octadecadienoate
CAS:Formula:C19H34O2Purity:>98%Color and Shape:LiquidMolecular weight:294.479(E),11(E)-Conjugated Linoleic Acid methyl ester
CAS:9(E),11(E)-Conjugated Linoleic Acid Methyl Ester, identified in thermally stressed cooking oils, can serve as an indicator for the adulteration of olive oils with lower quality oils. [Matreya, LLC. Catalog No. 1257]Formula:C19H34O2Color and Shape:SolidMolecular weight:294.479

