CymitQuimica logo

CAS 130384-98-4

:

N-BOC-Benzotriazole

Description:
N-BOC-Benzotriazole, with the CAS number 130384-98-4, is a chemical compound characterized by the presence of a benzotriazole moiety protected by a tert-butyloxycarbonyl (BOC) group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but is generally insoluble in water. The BOC group serves as a protective group for amines, allowing for selective reactions in synthetic chemistry. N-BOC-Benzotriazole is often utilized in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its structure contributes to its stability and reactivity, making it a valuable building block in chemical research. Additionally, benzotriazole derivatives are known for their applications in UV protection and corrosion inhibition, highlighting the versatility of this compound in various fields of chemistry. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions in laboratory settings.
Formula:C11H13N3O2
InChI:InChI=1/C11H13N3O2/c1-11(2,3)16-10(15)14-9-7-5-4-6-8(9)12-13-14/h4-7H,1-3H3
SMILES:CC(C)(C)OC(=O)n1c2ccccc2nn1
Synonyms:
  • N-Butoxycarbonylbenzotriazole
  • tert-butyl 1H-benzotriazole-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.