CAS 130387-76-7
:(biphenyl-4-ylmethyl)(chloro)magnesium
Description:
The chemical substance known as "(biphenyl-4-ylmethyl)(chloro)magnesium," with the CAS number 130387-76-7, is an organomagnesium compound that typically features a biphenyl moiety attached to a methyl group, along with a chlorine atom coordinated to a magnesium center. This compound is part of the Grignard reagent family, which are known for their reactivity, particularly in nucleophilic addition reactions. The presence of the biphenyl group can influence the compound's solubility and reactivity, making it useful in various organic synthesis applications. Organomagnesium compounds are generally sensitive to moisture and air, requiring careful handling under an inert atmosphere. They are often employed in the formation of carbon-carbon bonds, enabling the synthesis of complex organic molecules. Additionally, the chloromagnesium component suggests potential reactivity with electrophiles, further expanding its utility in synthetic chemistry. Overall, this compound exemplifies the versatility and importance of organometallic chemistry in the development of new materials and pharmaceuticals.
Formula:C13H11ClMg
InChI:InChI=1/C13H11.ClH.Mg/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;;/h2-10H,1H2;1H;/q;;+1/p-1/rC13H11ClMg/c14-15-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2
SMILES:C=C1C=CC(C=C1)c1ccccc1.Cl.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
