CAS 1303890-00-7

2-Methoxy-5-(1H-1,2,4-triazol-1-yl)-3-pyridinamine

Description:

2-Methoxy-5-(1H-1,2,4-triazol-1-yl)-3-pyridinamine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a triazole moiety. The presence of a methoxy group enhances its solubility and reactivity, while the triazole ring contributes to its potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen atoms in its structure. It may exhibit various properties such as moderate to high polarity, which can influence its interactions in biological systems. The compound's potential applications could span across pharmaceuticals, particularly in the development of antimicrobial or antifungal agents, owing to the biological significance of both the pyridine and triazole functionalities. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. As with many compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with its functional groups.

Formula: C₈H₉N₅O

InChI: InChI=1S/C8H9N5O/c1-14-8-7(9)2-6(3-11-8)13-5-10-4-12-13/h2-5H,9H2,1H3

InChI key: InChIKey=GPBVYMVRDXALHN-UHFFFAOYSA-N

SMILES: NC1=CC(=CN=C1OC)N2C=NC=N2

Synonyms:

• 2-Methoxy-5-(1H-1,2,4-triazol-1-yl)-3-pyridinamine
• 3-Pyridinamine, 2-methoxy-5-(1H-1,2,4-triazol-1-yl)-