CAS 1303890-29-0

5-(Aminothioxomethyl)-2-pyridinecarboxamide

Description:

5-(Aminothioxomethyl)-2-pyridinecarboxamide, identified by its CAS number 1303890-29-0, is a chemical compound that features a pyridine ring substituted with a carboxamide group and a thioxomethyl moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the amino and thioxomethyl functional groups. The thioxomethyl group can impart unique reactivity and stability properties, while the pyridine ring contributes to the compound's aromatic characteristics and potential for forming hydrogen bonds. The presence of the carboxamide group enhances solubility in polar solvents and may influence the compound's pharmacokinetic properties. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing molecules with specific biological activities. Further studies would be necessary to elucidate its precise mechanisms of action and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₇N₃OS

InChI: InChI=1S/C7H7N3OS/c8-6(11)5-2-1-4(3-10-5)7(9)12/h1-3H,(H2,8,11)(H2,9,12)

InChI key: InChIKey=JVRSNRXSOYFBMH-UHFFFAOYSA-N

SMILES: C(N)(=S)C=1C=CC(C(N)=O)=NC1

Synonyms:

• 2-Pyridinecarboxamide, 5-(aminothioxomethyl)-
• 5-(Aminothioxomethyl)-2-pyridinecarboxamide