CAS 1303890-44-9

Pyridine, 2-(4-piperidinylmethyl)-, hydrochloride (1:1)

Description:

Pyridine, 2-(4-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a pyridine ring substituted with a piperidinylmethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and chemical research. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. The compound is likely to exhibit basic properties due to the nitrogen atoms in both the pyridine and piperidine rings, allowing it to participate in protonation reactions. Its hydrochloride form indicates that it can exist as a stable solid at room temperature, and it may be used in synthesis or as an intermediate in the development of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₆N₂·ClH

InChI: InChI=1S/C11H16N2.ClH/c1-2-6-13-11(3-1)9-10-4-7-12-8-5-10;/h1-3,6,10,12H,4-5,7-9H2;1H

InChI key: InChIKey=KXLQQJNAIGTCKE-UHFFFAOYSA-N

SMILES: C(C1CCNCC1)C2=CC=CC=N2.Cl

Synonyms:

• Pyridine, 2-(4-piperidinylmethyl)-, hydrochloride (1:1)
• 2-[(Piperidin-4-yl)methyl]pyridine hydrochloride