CAS 13039-56-0
:5-DEOXY-L-ARABINOSE
Description:
5-Deoxy-L-arabinose is a naturally occurring sugar that belongs to the class of deoxysugars, which are sugars that lack one or more oxygen atoms compared to their corresponding aldoses. This compound is characterized by its five-carbon structure, specifically an arabinose configuration, which contributes to its unique stereochemistry and biological properties. It is typically a white crystalline solid that is soluble in water, making it accessible for various biochemical applications. 5-Deoxy-L-arabinose plays a significant role in the biosynthesis of certain antibiotics and is involved in the structure of some polysaccharides. Its presence in various biological systems highlights its importance in cellular processes. Additionally, due to its structural features, it can influence the activity of enzymes and interact with other biomolecules, making it a subject of interest in both medicinal chemistry and biochemistry. Overall, 5-deoxy-L-arabinose is a vital compound with implications in both natural product chemistry and potential therapeutic applications.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c1-2-3(6)4(7)5(8)9-2/h2-8H,1H3/t2-,3?,4+,5?/m0/s1
Synonyms:- 5-Methyl-tetrahydro-furan-2,3,4-triol
- L-5-Deoxyarabinose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Deoxy-L-arabinose
CAS:Formula:C5H10O4Purity:≥ 91.0%Color and Shape:Light yellow viscous liquidMolecular weight:134.135-Deoxy-L-arabinose
CAS:Controlled Product<p>Applications Shows strong inhibitory effect β-galactosidase of Escherichia coli.<br>References Huber, R. E., et al.: Biochemistry, 26, 1526 (1987),<br></p>Formula:C5H10O4Color and Shape:Light Yellow To YellowMolecular weight:134.135-Deoxy-L-arabinose
CAS:<p>5-Deoxy-L-arabinose is a tetramethylurea derivative that has been synthesized for the treatment of hyperphenylalaninemia, an atypical form of phenylketonuria. It is an analog of 5-deoxy-l-ribose and can be used to generate molybdate from ammonium molybdate. This product also has antiviral activity and can be used to inhibit the growth of filamentous fungi, such as Verticillium dahliae. 5-Deoxy-L-arabinose can be used as a phase separator in chromatography. It is stereoselective and does not react with acid catalysts.</p>Formula:C5H10O4Purity:Min. 95%Color and Shape:Slightly Yellow Clear Viscous LiquidMolecular weight:134.13 g/mol5-Deoxy α-L-arabinose and 5-Deoxy β-L-arabinose
CAS:<p>5-Deoxy alpha-L-arabinose and 5-Deoxy beta-L-arabinose are enantiopure compounds that are used in the synthesis of 5-deoxy-l-ribose, which is a precursor to nucleic acids. The reaction products are produced by hydrolyzing rhamnan with hydrochloric acid. This product can be used as a substrate for DNA polymerase and RNA polymerase, which are enzymes involved in the synthesis of nucleic acids. This product also has an acidic nature, which makes it suitable for use in phase chromatography. It has been shown to have stereoselective properties and can be used as an acid catalyst for other reactions.</p>Formula:C5H10O4Purity:Min. 95 Area-%Molecular weight:134.13 g/molRef: 3D-W-201034
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire



