CAS 13039-56-0: 5-DEOXY-L-ARABINOSE

Description:5-Deoxy-L-arabinose is a naturally occurring sugar that belongs to the class of deoxysugars, which are sugars that lack one or more oxygen atoms compared to their corresponding aldoses. This compound is characterized by its five-carbon structure, specifically an arabinose configuration, which contributes to its unique stereochemistry and biological properties. It is typically a white crystalline solid that is soluble in water, making it accessible for various biochemical applications. 5-Deoxy-L-arabinose plays a significant role in the biosynthesis of certain antibiotics and is involved in the structure of some polysaccharides. Its presence in various biological systems highlights its importance in cellular processes. Additionally, due to its structural features, it can influence the activity of enzymes and interact with other biomolecules, making it a subject of interest in both medicinal chemistry and biochemistry. Overall, 5-deoxy-L-arabinose is a vital compound with implications in both natural product chemistry and potential therapeutic applications.

Formula:C₅H₁₀O₄

InChI:InChI=1/C5H10O4/c1-2-3(6)4(7)5(8)9-2/h2-8H,1H3/t2-,3?,4+,5?/m0/s1

Synonyms:
5-Methyl-tetrahydro-furan-2,3,4-triol
L-5-Deoxyarabinose

Found 5 products.

Product data	Purity	Price range	Estimated delivery
L-Arabinose, 5-deoxy- REF: IN-DA000UD9CAS: 13039-56-0	95%	165.00 €~511.00 €	Tue 15 Apr 25
5-Deoxy-L-arabinose REF: 7W-GC2301CAS: 13039-56-0	≥ 91.0%	To inquire	Wed 16 Apr 25
5-Deoxy-L-arabinose REF: TR-D232100CAS: 13039-56-0	- - -	274.00 €~1,809.00 €	Fri 25 Apr 25
5-Deoxy-L-arabinose REF: 3D-MD02033CAS: 13039-56-0	Min. 95%	145.00 €~1,393.00 €	Mon 28 Apr 25
5-Deoxy α-L-arabinose and 5-Deoxy β-L-arabinose REF: 3D-W-201034CAS: 13039-56-0	Min. 95 Area-%	To inquire	Tue 27 May 25