CAS 13039-56-0

5-DEOXY-L-ARABINOSE

Description:

5-Deoxy-L-arabinose is a naturally occurring sugar that belongs to the class of deoxysugars, which are sugars that lack one or more oxygen atoms compared to their corresponding aldoses. This compound is characterized by its five-carbon structure, specifically an arabinose configuration, which contributes to its unique stereochemistry and biological properties. It is typically a white crystalline solid that is soluble in water, making it accessible for various biochemical applications. 5-Deoxy-L-arabinose plays a significant role in the biosynthesis of certain antibiotics and is involved in the structure of some polysaccharides. Its presence in various biological systems highlights its importance in cellular processes. Additionally, due to its structural features, it can influence the activity of enzymes and interact with other biomolecules, making it a subject of interest in both medicinal chemistry and biochemistry. Overall, 5-deoxy-L-arabinose is a vital compound with implications in both natural product chemistry and potential therapeutic applications.

Formula: C₅H₁₀O₄

InChI: InChI=1/C5H10O4/c1-2-3(6)4(7)5(8)9-2/h2-8H,1H3/t2-,3?,4+,5?/m0/s1

InChI key: WDRISBUVHBMJEF-YUPRTTJUSA-N

SMILES: C[C@@H]([C@@H]([C@H](C=O)O)O)O

Synonyms:

• 5-Methyl-tetrahydro-furan-2,3,4-triol
• L-5-Deoxyarabinose

5-Deoxy-L-arabinose

CAS: 13039-56-0

5-Deoxy-L-arabinose

Formula: C₅H₁₀O₄

Purity: ≥95%

Molecular weight: 134.13

Ref: 54-OR1108428

5-Deoxy-L-arabinose

CAS: 13039-56-0

Formula: C₅H₁₀O₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 134.1305

Ref: IN-DA000UD9

5-Deoxy-L-arabinose

CAS: 13039-56-0

Formula: C₅H₁₀O₄

Purity: ≥ 91.0%

Color and Shape: Light yellow viscous liquid

Molecular weight: 134.13

Ref: 7W-GC2301

5-Deoxy-L-arabinose

Controlled Product

CAS: 13039-56-0

Applications Shows strong inhibitory effect β-galactosidase of Escherichia coli.
References Huber, R. E., et al.: Biochemistry, 26, 1526 (1987),

Formula: C₅H₁₀O₄

Color and Shape: Neat

Molecular weight: 134.13

Ref: TR-D232100

5-Deoxy-L-arabinose

CAS: 13039-56-0

5-Deoxy-L-arabinose is a tetramethylurea derivative that has been synthesized for the treatment of hyperphenylalaninemia, an atypical form of phenylketonuria. It is an analog of 5-deoxy-l-ribose and can be used to generate molybdate from ammonium molybdate. This product also has antiviral activity and can be used to inhibit the growth of filamentous fungi, such as Verticillium dahliae. 5-Deoxy-L-arabinose can be used as a phase separator in chromatography. It is stereoselective and does not react with acid catalysts.

Formula: C₅H₁₀O₄

Purity: Min. 95%

Color and Shape: Slightly Yellow Clear Viscous Liquid

Molecular weight: 134.13 g/mol

Ref: 3D-MD02033