CymitQuimica logo

CAS 1303967-89-6

:

Methyl-[1-(2-Methyl-benzyl)-piperidin-4-yl]-aMine hydrochloride

Description:
Methyl-[1-(2-Methyl-benzyl)-piperidin-4-yl]-amine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. This compound features a methyl group and a 2-methyl-benzyl substituent, contributing to its unique structural and functional properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their effects on the central nervous system and other therapeutic areas. The compound's molecular structure may influence its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Safety and handling considerations are essential, as with any chemical substance, and proper laboratory protocols should be followed when working with it. Overall, this compound represents a specific class of organic molecules with potential applications in medicinal chemistry and drug development.
Formula:C14H23ClN2
InChI:InChI=1S/C14H22N2.ClH/c1-12-5-3-4-6-13(12)11-16-9-7-14(15-2)8-10-16;/h3-6,14-15H,7-11H2,1-2H3;1H
InChI key:DFQCSEJYHQAQOW-UHFFFAOYSA-N
SMILES:CC1=CC=CC=C1CN2CCC(CC2)NC.Cl
Synonyms:
  • N-Methyl-1-(2-Methylbenzyl)piperidin-4-aMine hydrochloride
  • hydrochloride
  • Methyl-[1-(2-Methyl-benzyl)-piperidin-4-yl]-aMine
Found 3 products.