CAS 1303968-02-6

4-Chloro-6-(4-pyridinyl)-1,3,5-triazin-2-amine

Description:

4-Chloro-6-(4-pyridinyl)-1,3,5-triazin-2-amine is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. The presence of a chloro group at the 4-position and a pyridinyl group at the 6-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure suggests potential for hydrogen bonding, which can influence its interactions with biological targets. The compound may also display specific biological activities, making it of interest for research in medicinal chemistry. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or environmental impact. Overall, 4-Chloro-6-(4-pyridinyl)-1,3,5-triazin-2-amine is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₆ClN₅

InChI: InChI=1S/C8H6ClN5/c9-7-12-6(13-8(10)14-7)5-1-3-11-4-2-5/h1-4H,(H2,10,12,13,14)

InChI key: InChIKey=JLKMXSJVSADARN-UHFFFAOYSA-N

SMILES: ClC1=NC(=NC(N)=N1)C=2C=CN=CC2

Synonyms:

• 4-Chloro-6-(4-pyridinyl)-1,3,5-triazin-2-amine
• 1,3,5-Triazin-2-amine, 4-chloro-6-(4-pyridinyl)-