CAS 1303968-07-1

2-Azaspiro[3.5]nonane, hydrochloride (1:1)

Description:

2-Azaspiro[3.5]nonane, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which consists of a nitrogen atom incorporated into a bicyclic framework. This compound typically exhibits properties associated with amines, including basicity due to the presence of the nitrogen atom. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which enhances its solubility in water and may influence its pharmacological properties. The spirocyclic nature of the molecule contributes to its potential biological activity, making it of interest in medicinal chemistry. Compounds like this are often studied for their effects on neurotransmitter systems, and they may exhibit psychoactive properties. The specific stereochemistry and functional groups present can significantly affect the compound's reactivity and interactions with biological targets. As with many nitrogen-containing heterocycles, 2-Azaspiro[3.5]nonane may also participate in various chemical reactions, including alkylation and acylation, making it a versatile building block in organic synthesis.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c1-2-4-8(5-3-1)6-9-7-8;/h9H,1-7H2;1H

InChI key: InChIKey=XNCHACXHZLHDOE-UHFFFAOYSA-N

SMILES: C12(CNC1)CCCCC2.Cl

Synonyms:

• 2-Azaspiro[3.5]nonane, hydrochloride (1:1)

2-​Azaspiro[3.5]​nonane, hydrochloride (1:1)

CAS: 1303968-07-1

Formula: C₈H₁₆ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.6723

Ref: IN-DA009K2C

2-Azaspiro[3.5]nonane hydrochloride

CAS: 1303968-07-1

2-Azaspiro[3.5]nonane hydrochloride

Purity: 98%

Molecular weight: 161.67g/mol

Ref: 54-OR95103

2-Azaspiro[3.5]nonane hydrochloride

CAS: 1303968-07-1

2-Azaspiro[3.5]nonane hydrochloride is a high quality reagent that is used as an intermediate for the synthesis of complex organic compounds, such as fine chemicals and speciality chemicals. It has been shown to be useful in the synthesis of a variety of chemical compounds, including research chemicals and versatile building blocks. This compound has the CAS number 1303968-07-1.

Formula: C₈H₁₅N·HCl

Purity: Min. 95%

Molecular weight: 161.67 g/mol

Ref: 3D-DCC96807

2-Azaspiro[3.5]nonane hydrochloride

CAS: 1303968-07-1

Formula: C₈H₁₆ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.67

Ref: 10-F463565