CAS 1303968-18-4

3-Thiopheneethanamine, 2-bromo-, hydrochloride (1:1)

Description:

3-Thiopheneethanamine, 2-bromo-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential reactivity. The presence of a bromine atom at the second position of the ethylamine side chain enhances its electrophilic characteristics, making it useful in various synthetic applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in biological and chemical processes. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems or serving as a precursor in the synthesis of pharmaceuticals. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Thiopheneethanamine, 2-bromo-, hydrochloride is of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.

Formula: C₆H₈BrNS·ClH

InChI: InChI=1S/C6H8BrNS.ClH/c7-6-5(1-3-8)2-4-9-6;/h2,4H,1,3,8H2;1H

InChI key: InChIKey=YGLGWOFAIHAXME-UHFFFAOYSA-N

SMILES: C(CN)C1=C(Br)SC=C1.Cl

Synonyms:

• 3-Thiopheneethanamine, 2-bromo-, hydrochloride (1:1)