CAS 1303968-20-8

6-Azaspiro[4.5]decan-9-one, 10-methyl-, hydrochloride (1:1)

Description:

6-Azaspiro[4.5]decan-9-one, 10-methyl-, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which incorporates a nitrogen atom within a bicyclic framework. This compound features a ketone functional group and a methyl substituent at the 10-position, contributing to its unique reactivity and potential biological activity. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in aqueous environments, which is often advantageous for pharmacological applications. The presence of the azaspiro moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. As with many nitrogen-containing heterocycles, it may exhibit various biological activities, including antimicrobial or psychoactive effects. However, specific data on its toxicity, stability, and detailed biological profile would require further investigation through experimental studies and literature reviews.

Formula: C₁₀H₁₇NO·ClH

InChI: InChI=1S/C10H17NO.ClH/c1-8-9(12)4-7-11-10(8)5-2-3-6-10;/h8,11H,2-7H2,1H3;1H

InChI key: InChIKey=AGVPGLCDHZYMIS-UHFFFAOYSA-N

SMILES: CC1C2(NCCC1=O)CCCC2.Cl

Synonyms:

• 6-Azaspiro[4.5]decan-9-one, 10-methyl-, hydrochloride (1:1)