CymitQuimica logo

CAS 1303968-23-1

:

8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:
8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of a carboxylic acid moiety indicates potential for acidic behavior, while the ester functionality suggests it can undergo hydrolysis or participate in esterification reactions. The compound also features an amino group, which can engage in hydrogen bonding and may influence its solubility and reactivity. The hydrochloride form indicates that the compound is a salt, enhancing its stability and solubility in polar solvents, particularly water. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including pharmacological evaluations. Overall, this compound's unique structural characteristics suggest potential utility in various chemical and pharmaceutical applications.
Formula:C12H22N2O2·ClH
InChI:InChI=1S/C12H22N2O2.ClH/c1-12(2,3)16-11(15)14-9-4-5-10(14)7-8(13)6-9;/h8-10H,4-7,13H2,1-3H3;1H
InChI key:InChIKey=HZCRCTGSLIZGOT-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2CCC1CC(N)C2.Cl
Synonyms:
  • 8-Azabicyclo[3.2.1]octane-8-carboxylic acid, 3-amino-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.