CAS 1303968-36-6

1,1-Dimethylethyl 4-formyl-1H-imidazole-1-acetate

Description:

1,1-Dimethylethyl 4-formyl-1H-imidazole-1-acetate, identified by its CAS number 1303968-36-6, is a chemical compound that features a unique structure combining an imidazole ring with an acetate group and a formyl substituent. This compound is characterized by its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the imidazole moiety, which is known for its biological activity. The presence of the formyl group suggests reactivity that could facilitate further chemical transformations, while the acetate group may enhance solubility and stability. The tert-butyl group (1,1-dimethylethyl) contributes to steric hindrance, which can influence the compound's reactivity and interactions with other molecules. Overall, this compound's structural features suggest it may exhibit interesting chemical properties and biological activities, making it a subject of interest for further research in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₄N₂O₃

InChI: InChI=1S/C10H14N2O3/c1-10(2,3)15-9(14)5-12-4-8(6-13)11-7-12/h4,6-7H,5H2,1-3H3

InChI key: InChIKey=LEWZWPLHBKKQGT-UHFFFAOYSA-N

SMILES: C(C(OC(C)(C)C)=O)N1C=C(C=O)N=C1

Synonyms:

• 1H-Imidazole-1-acetic acid, 4-formyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-formyl-1H-imidazole-1-acetate