CAS 1303968-40-2

4-Formyl-1H-imidazole-1-acetic acid

Description:

4-Formyl-1H-imidazole-1-acetic acid is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a formyl group (-CHO) and an acetic acid moiety (-COOH) attached to the imidazole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a ligand in coordination chemistry. Its structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. Additionally, the presence of both aldehyde and carboxylic acid functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. As with many imidazole derivatives, it may also exhibit antimicrobial or antifungal properties, making it of interest in various fields of research.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c9-3-5-1-8(4-7-5)2-6(10)11/h1,3-4H,2H2,(H,10,11)

InChI key: InChIKey=XCCISDPUPNBLOF-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=C(C=O)N=C1

Synonyms:

• 4-Formyl-1H-imidazole-1-acetic acid
• 1H-Imidazole-1-acetic acid, 4-formyl-