CymitQuimica logo

CAS 1303968-41-3

:

2-Pyridinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:2)

Description:
2-Pyridinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the para position enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as basicity due to the amine functional group, allowing it to participate in protonation reactions. Its unique structure suggests potential uses in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the trifluoromethyl group is known to impart metabolic stability and can modulate the electronic properties of the molecule, making it a subject of interest in drug design and development. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can exhibit unique environmental and health impacts.
Formula:C7H7F3N2·2ClH
InChI:InChI=1S/C7H7F3N2.2ClH/c8-7(9,10)5-1-2-12-6(3-5)4-11;;/h1-3H,4,11H2;2*1H
InChI key:InChIKey=YSPLBTPWLDROMH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CN)N=CC1.Cl
Synonyms:
  • 2-Pyridinemethanamine, 4-(trifluoromethyl)-, hydrochloride (1:2)
  • [4-(Trifluoromethyl)-2-pyridyl]methanamine dihydrochloride
Found 3 products.