CymitQuimica logo

CAS 1303968-49-1

:

3-Pyridineethanamine, 6-phenoxy-, hydrochloride (1:2)

Description:
3-Pyridineethanamine, 6-phenoxy-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and phenoxy functional groups, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the pyridine ring suggests that it may exhibit basic properties, while the phenoxy group can influence its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential role as a pharmacophore, possibly affecting neurotransmitter systems or other biological pathways. Its molecular structure likely allows for specific interactions with receptors or enzymes, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C13H14N2O·2ClH
InChI:InChI=1S/C13H14N2O.2ClH/c14-9-8-11-6-7-13(15-10-11)16-12-4-2-1-3-5-12;;/h1-7,10H,8-9,14H2;2*1H
InChI key:InChIKey=AUQPQBFVIINDEK-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CCN)C=N1)C2=CC=CC=C2.Cl
Synonyms:
  • 3-Pyridineethanamine, 6-phenoxy-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.