CymitQuimica logo

CAS 1303973-03-6

:

4,4-Difluoro-1-(phenylmethyl)-3-piperidinecarboxylic acid

Description:
4,4-Difluoro-1-(phenylmethyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of two fluorine atoms at the 4-position of the piperidine ring contributes to its unique reactivity and potential biological activity. The phenylmethyl group attached to the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, melting point, and stability, would depend on the molecular environment and conditions. Overall, 4,4-Difluoro-1-(phenylmethyl)-3-piperidinecarboxylic acid represents a class of compounds that could have significant implications in pharmaceutical research and development.
Formula:C13H15F2NO2
InChI:InChI=1S/C13H15F2NO2/c14-13(15)6-7-16(9-11(13)12(17)18)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,18)
InChI key:InChIKey=WBRNNFLFAOMTSK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(F)(F)CCN(CC2=CC=CC=C2)C1
Synonyms:
  • 4,4-Difluoro-1-(phenylmethyl)-3-piperidinecarboxylic acid
  • 3-Piperidinecarboxylic acid, 4,4-difluoro-1-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.