CAS 1303974-25-5

1-(Phenylmethyl) 4,4-difluoro-1,3-piperidinedicarboxylate

Description:

1-(Phenylmethyl) 4,4-difluoro-1,3-piperidinedicarboxylate, identified by its CAS number 1303974-25-5, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing nitrogen. This compound features two carboxylate ester groups, contributing to its potential reactivity and solubility in various solvents. The presence of difluoro substituents at the 4-position of the piperidine ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The phenylmethyl group attached to the nitrogen atom adds to its structural complexity and can affect its interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further explored through various analytical methods to assess its stability, reactivity, and biological efficacy.

Formula: C₁₄H₁₅F₂NO₄

InChI: InChI=1S/C14H15F2NO4/c15-14(16)6-7-17(8-11(14)12(18)19)13(20)21-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,18,19)

InChI key: InChIKey=BESFNGRFFPFNNQ-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(C(O)=O)C(F)(F)CC2

Synonyms:

• 1-(Phenylmethyl) 4,4-difluoro-1,3-piperidinedicarboxylate
• 1,3-Piperidinedicarboxylic acid, 4,4-difluoro-, 1-(phenylmethyl) ester