CAS 1303993-76-1

N-[2,4-Dibromo-6-(trifluoromethoxy)phenyl]thiourea

Description:

N-[2,4-Dibromo-6-(trifluoromethoxy)phenyl]thiourea is a chemical compound characterized by its unique structure, which includes a thiourea functional group and a phenyl ring substituted with bromine and trifluoromethoxy groups. The presence of bromine atoms contributes to its potential reactivity and biological activity, while the trifluoromethoxy group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically used in research settings, particularly in studies related to agrochemicals or pharmaceuticals, due to its potential as a bioactive agent. Its molecular structure suggests that it may exhibit interesting properties such as antimicrobial or herbicidal activity. Additionally, the presence of halogen atoms often indicates a compound's potential for environmental persistence and bioaccumulation, which are important considerations in its application and regulation. Safety data sheets and handling guidelines should be consulted for specific toxicity and safety information, as compounds with similar structures can vary widely in their biological effects.

Formula: C₈H₅Br₂F₃N₂OS

InChI: InChI=1S/C8H5Br2F3N2OS/c9-3-1-4(10)6(15-7(14)17)5(2-3)16-8(11,12)13/h1-2H,(H3,14,15,17)

InChI key: InChIKey=XCTZHIPSTAOPNG-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(NC(N)=S)C(Br)=CC(Br)=C1

Synonyms:

• Thiourea, N-[2,4-dibromo-6-(trifluoromethoxy)phenyl]-
• N-[2,4-Dibromo-6-(trifluoromethoxy)phenyl]thiourea
• [2,4-dibromo-6-(trifluoromethoxy)phenyl]thiourea