CAS 13040-21-6

N-(3-hydroxyphenyl)prop-2-enamide

Description:

N-(3-hydroxyphenyl)prop-2-enamide, also known as 3-hydroxycinnamide, is an organic compound characterized by its amide functional group and a phenolic hydroxyl group. It features a prop-2-enamide backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity and potential for various chemical transformations. The presence of the hydroxyl group on the aromatic ring enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically synthesized through the reaction of 3-hydroxyaniline with an appropriate acylating agent. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or antioxidant properties. Additionally, the compound's ability to participate in hydrogen bonding due to the hydroxyl group may affect its interactions in biological systems. Overall, N-(3-hydroxyphenyl)prop-2-enamide is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c1-2-9(12)10-7-4-3-5-8(11)6-7/h2-6,11H,1H2,(H,10,12)

SMILES: C=CC(=Nc1cccc(c1)O)O

Synonyms:

• N-(3-Hydroxy-phenyl)-acrylamide

N-(3-Hydroxyphenyl)acrylamide

CAS: 13040-21-6

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1733

Ref: IN-DA009C4F

N-(3-Hydroxyphenyl)Prop-2-Enamide

CAS: 13040-21-6

N-(3-Hydroxyphenyl)Prop-2-Enamide

Purity: 99%

Molecular weight: 163.17g/mol

Ref: 54-OR1028257

N-(3-Hydroxyphenyl)acrylamide

CAS: 13040-21-6

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.176

Ref: 10-F053774