CymitQuimica logo

CAS 130408-18-3

:

4,7-Difluoro-1H-indene

Description:
4,7-Difluoro-1H-indene is an organic compound characterized by its indene structure, which consists of a fused benzene and cyclopentene ring. The presence of two fluorine atoms at the 4 and 7 positions of the indene ring significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in organic synthesis and materials science, particularly in the development of fluorinated compounds. The fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical reactions and processes. Additionally, 4,7-difluoro-1H-indene may exhibit unique interactions with other chemical species due to the electronegative nature of fluorine, which can affect its solubility and behavior in different solvents. As with many fluorinated compounds, safety precautions should be taken when handling it, as fluorinated organic compounds can exhibit toxicity and environmental persistence.
Formula:C9H6F2
InChI:InChI=1S/C9H6F2/c10-8-4-5-9(11)7-3-1-2-6(7)8/h1-2,4-5H,3H2
InChI key:InChIKey=LDHQXNMFGYGNJT-UHFFFAOYSA-N
SMILES:FC1=C2C(=C(F)C=C1)C=CC2
Synonyms:
  • 4,7-Difluoroindene
  • 4,7-Difluoro-1H-indene
  • 1H-Indene, 4,7-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.