
CAS 130416-47-6
:α,α-Dimethyl-3-phenoxybenzenemethanamine
Description:
α,α-Dimethyl-3-phenoxybenzenemethanamine, with the CAS number 130416-47-6, is a chemical compound characterized by its unique structure, which includes a phenoxy group and a dimethylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. It is likely to be a solid at room temperature, with potential applications in various fields, including pharmaceuticals and agrochemicals, due to its structural features that may influence biological activity. The presence of the phenoxy group suggests potential interactions with biological targets, while the dimethyl groups may enhance lipophilicity, affecting its solubility and permeability. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential hazards associated with exposure. Overall, α,α-Dimethyl-3-phenoxybenzenemethanamine represents a compound of interest for further research and application in chemical synthesis and medicinal chemistry.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-15(2,16)12-7-6-10-14(11-12)17-13-8-4-3-5-9-13/h3-11H,16H2,1-2H3
InChI key:InChIKey=KESCECWBPFGYAG-UHFFFAOYSA-N
SMILES:O(C1=CC(C(C)(C)N)=CC=C1)C2=CC=CC=C2
Synonyms:- α,α-Dimethyl-3-phenoxybenzenemethanamine
- 2-(3-Phenoxyphenyl)propan-2-amine
- Benzenemethanamine, α,α-dimethyl-3-phenoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.