CymitQuimica logo

CAS 13042-55-2

:

1,5-DIDEOXY-1,5-IMINO-XYLITOL

Description:
1,5-Dideoxy-1,5-imino-xylitol, with the CAS number 13042-55-2, is a chemical compound that belongs to the class of iminosugars. These compounds are characterized by their structural similarity to sugars but contain nitrogen in place of one or more oxygen atoms. This particular iminosugar is notable for its potential biological activity, particularly in the context of glycosidase inhibition, which can have implications in the treatment of various diseases, including diabetes and viral infections. The compound is typically a white to off-white solid and is soluble in water, making it accessible for various biochemical applications. Its unique structure allows it to interact with enzymes involved in carbohydrate metabolism, potentially leading to altered metabolic pathways. Research into 1,5-dideoxy-1,5-imino-xylitol continues to explore its pharmacological properties and therapeutic potential, particularly in the realm of medicinal chemistry and drug development.
Formula:C5H11NO3
InChI:InChI=1/C5H11NO3/c7-3-1-6-2-4(8)5(3)9/h3-9H,1-2H2/t3-,4+,5+
Synonyms:
  • 13042-55-2
  • (3R,4r,5S)-piperidine-3,4,5-triol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.