CAS 130434-40-1

2-fluoro-N-n-propylnorapomorphine

Description:

2-Fluoro-N-n-propylnorapomorphine is a synthetic chemical compound that belongs to the class of norapomorphine derivatives, which are known for their potential pharmacological effects, particularly in the central nervous system. This compound features a fluorine atom at the 2-position of the aromatic ring and a propyl group attached to the nitrogen atom, which influences its biological activity and receptor binding properties. The presence of the fluorine atom can enhance lipophilicity and alter the compound's interaction with various biological targets, including dopamine receptors. As a derivative of norapomorphine, it may exhibit both agonistic and antagonistic properties, making it of interest in research related to neuropharmacology and potential therapeutic applications. However, detailed studies on its pharmacodynamics, pharmacokinetics, and safety profile are essential to fully understand its characteristics and potential uses. As with many synthetic compounds, the specific effects and mechanisms of action would require further investigation through experimental studies.

Formula: C₁₉H₂₁BrFNO₂

InChI: InChI=1/C19H20FNO2.BrH/c1-2-6-21-7-5-12-8-13(20)10-14-17(12)15(21)9-11-3-4-16(22)19(23)18(11)14;/h3-4,8,10,15,22-23H,2,5-7,9H2,1H3;1H/t15-;/m1./s1

SMILES: CCCN1CCc2cc(cc3c2[C@H]1Cc1ccc(c(c31)O)O)F.Br

Synonyms:

• (-)-2-Fluoro-npa
• 2-F-Npa
• 4H-Dibenzo(de,g)quinoline-10,11-diol, 2-fluoro-5,6,6a,7-tetrahydro-6-propyl-, hydrobromide, (R)-
• (6aR)-2-fluoro-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol hydrobromide (1:1)