CymitQuimica logo

CAS 130464-05-0

:

Pyridine, 2-(2R)-2-pyrrolidinyl- (9CI)

Description:
Pyridine, 2-(2R)-2-pyrrolidinyl- (9CI), with the CAS number 130464-05-0, is a heterocyclic organic compound characterized by its pyridine and pyrrolidine functional groups. It features a six-membered aromatic ring containing one nitrogen atom (pyridine) and a five-membered saturated ring (pyrrolidine) that contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and organic solvents, which enhances its utility in various chemical applications. Pyridine derivatives are known for their role as bases and nucleophiles in organic synthesis, and this specific compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural configuration, particularly the stereochemistry of the pyrrolidine moiety, can influence its reactivity and interaction with biological targets. Safety considerations include potential toxicity and irritant properties, necessitating proper handling and storage protocols in laboratory settings.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-2,4,6,9,11H,3,5,7H2/t9-/m1/s1
InChI key:NDCZQFDBSPOUDF-SECBINFHSA-N
SMILES:C1C[C@@H](NC1)C2=CC=CC=N2
Found 4 products.