CymitQuimica logo

CAS 130465-45-1

:

(1R,3S)-1-(Aminomethyl)-3,4-dihydro-3-phenyl-1H-2-benzopyran-5,6-diol

Description:
The chemical substance known as (1R,3S)-1-(Aminomethyl)-3,4-dihydro-3-phenyl-1H-2-benzopyran-5,6-diol, with the CAS number 130465-45-1, is a complex organic compound characterized by its unique structural features. It contains a benzopyran core, which is a fused ring system comprising a benzene ring and a pyran ring, contributing to its aromatic properties. The presence of an aminomethyl group indicates that it has an amine functional group, which can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. The stereochemistry, denoted by the (1R,3S) configuration, suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions. This compound may exhibit potential pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific functional groups present and the overall molecular structure, which can affect its applications in drug development or as a biochemical probe.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c17-9-15-11-6-7-13(18)16(19)12(11)8-14(20-15)10-4-2-1-3-5-10/h1-7,14-15,18-19H,8-9,17H2/t14-,15-/m0/s1
InChI key:InChIKey=SUHGRZPINGKYNV-GJZGRUSLSA-N
SMILES:C(N)[C@H]1C=2C(C[C@H](O1)C3=CC=CC=C3)=C(O)C(O)=CC2
Synonyms:
  • 1H-2-Benzopyran-5,6-diol, 1-(aminomethyl)-3,4-dihydro-3-phenyl-, (1R-cis)-
  • 1H-2-Benzopyran-5,6-diol, 1-(aminomethyl)-3,4-dihydro-3-phenyl-, (1R,3S)-
  • (1R,3S)-1-(Aminomethyl)-3,4-dihydro-3-phenyl-1H-2-benzopyran-5,6-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.