CAS 13047-13-7: Dimezone S
Description:Dimezone S, with the CAS number 13047-13-7, is a chemical compound primarily used as a pharmaceutical agent, particularly in the treatment of certain medical conditions. It is classified as a sulfonamide, which means it contains a sulfonamide group (-SO2NH2) that contributes to its biological activity. Dimezone S exhibits properties such as antibacterial activity, making it effective against a range of bacterial infections. The compound is typically administered in specific dosages, and its pharmacokinetics involve absorption, distribution, metabolism, and excretion processes that are crucial for its therapeutic efficacy. Additionally, Dimezone S may have side effects and contraindications that need to be considered during its use. Its chemical structure includes various functional groups that influence its solubility and reactivity. As with many pharmaceuticals, the safety and efficacy of Dimezone S are evaluated through clinical studies, and it is essential to follow regulatory guidelines for its use in medical applications.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c1-11(8-14)7-13(12-10(11)15)9-5-3-2-4-6-9/h2-6,14H,7-8H2,1H3,(H,12,15)
InChI key:InChIKey=DSVIHYOAKPVFEH-UHFFFAOYSA-N
SMILES:O=C1NN(C=2C=CC=CC2)CC1(C)CO
- Synonyms:
- (4R)-4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one
- (4S)-4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one
- 1-Phenyl-4-(hydroxymethyl)-4-methyl-3-pyrazolidone
- 1-Phenyl-4-methyl-4-(hydroxymethyl)-3-pyrazolidinone
- 1-Phenyl-4-methyl-4-hydroxymethyl-3-pyrazolidone
- 3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl-
- 4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidinone
- 4-(Hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one
- Dimezone S
- Phenidone S
- See more synonyms
- 4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidone

3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl-
Ref: IN-DA000UHA
25g | 26.00 € | ||
100g | 61.00 € | ||
500g | 153.00 € |

4-(Hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one
Ref: 54-OR95444
500g | 184.00 € |

4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidone
Ref: 7W-GK3530
25g | 137.00 € |

4-HYDROXYMETHYL-4-METHYL-1-PHENYL-3-PYRAZOLIDONE
Ref: 10-F845063
500g | 162.00 € |

4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidinone
Ref: 3D-FH05501
10g | Discontinued | Request information | |
50g | Discontinued | Request information | |
25kg | Discontinued | Request information |