
CAS 130473-32-4
:6-Acetyl-2,2-dimethyl-4H-1,3-dioxin-4-one
Description:
6-Acetyl-2,2-dimethyl-4H-1,3-dioxin-4-one, with the CAS number 130473-32-4, is an organic compound characterized by its unique dioxin structure, which includes a dioxin ring and an acetyl functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure features two methyl groups and an acetyl group, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the dioxin moiety suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and material science. However, specific safety and handling precautions should be observed due to the potential toxicity associated with dioxin derivatives. Overall, 6-Acetyl-2,2-dimethyl-4H-1,3-dioxin-4-one represents a versatile compound with implications in both research and industrial applications.
Formula:C8H10O4
InChI:InChI=1S/C8H10O4/c1-5(9)6-4-7(10)12-8(2,3)11-6/h4H,1-3H3
InChI key:InChIKey=AEDNJAZCQCXWHR-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1OC(C)(C)OC(=O)C1
Synonyms:- 6-Acetyl-2,2-dimethyl-4H-1,3-dioxin-4-one
- 4H-1,3-Dioxin-4-one, 6-acetyl-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
