CymitQuimica logo

CAS 130474-49-6

:

4-[(5-Bromopentyl)oxy]-4′-methoxy-1,1′-biphenyl

Description:
4-[(5-Bromopentyl)oxy]-4′-methoxy-1,1′-biphenyl, with CAS number 130474-49-6, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at one of the para positions on the biphenyl and a bromopentyl ether substituent at the other para position contributes to its unique chemical properties. This compound is likely to exhibit moderate lipophilicity due to the long alkyl chain provided by the bromopentyl group, which can influence its solubility in organic solvents and its interaction with biological membranes. The bromine atom introduces a halogen, which can enhance reactivity and may participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the biphenyl system and the substituents, potentially making it relevant in materials science or medicinal chemistry. Its specific applications and behavior would depend on further studies and context within chemical research.
Formula:C18H21BrO2
InChI:InChI=1S/C18H21BrO2/c1-20-17-9-5-15(6-10-17)16-7-11-18(12-8-16)21-14-4-2-3-13-19/h5-12H,2-4,13-14H2,1H3
InChI key:InChIKey=NLNGECSEFVJODC-UHFFFAOYSA-N
SMILES:O(CCCCCBr)C1=CC=C(C=C1)C2=CC=C(OC)C=C2
Synonyms:
  • 4-[(5-Bromopentyl)oxy]-4′-methoxy-1,1′-biphenyl
  • 1,1′-Biphenyl, 4-[(5-bromopentyl)oxy]-4′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.