CymitQuimica logo

CAS 1304771-28-5

:

2-(Phenylmethoxy)thiazole

Description:
2-(Phenylmethoxy)thiazole is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a phenylmethoxy group, indicating that a phenyl group is attached to a methoxy (-O-CH2-) moiety, which is further linked to the thiazole ring. The thiazole structure contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the phenylmethoxy group may enhance its lipophilicity, influencing its solubility and permeability properties. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic and heterocyclic systems. Its applications could range from medicinal chemistry to materials science, depending on its specific reactivity and interactions with biological targets. As with many organic compounds, the stability, reactivity, and potential applications of 2-(Phenylmethoxy)thiazole can be influenced by its molecular structure and the functional groups present.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c1-2-4-9(5-3-1)8-12-10-11-6-7-13-10/h1-7H,8H2
InChI key:InChIKey=BIRGVLSJJBNEGP-UHFFFAOYSA-N
SMILES:C(OC1=NC=CS1)C2=CC=CC=C2
Synonyms:
  • Thiazole, 2-(phenylmethoxy)-
  • 2-(Benzyloxy)-1,3-thiazole
  • 2-(Phenylmethoxy)thiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.