CAS 130482-21-2
:iodoethylspiperone
Description:
Iodoethylspiperone is a chemical compound that belongs to the class of spiperone derivatives, which are known for their pharmacological properties, particularly in the field of neuroscience and psychiatry. This compound features a spiperone backbone with an iodoethyl substituent, which contributes to its unique chemical characteristics. Iodoethylspiperone is primarily recognized for its affinity for dopamine receptors, making it a valuable tool in research related to neuropharmacology and the study of psychiatric disorders. The presence of iodine in its structure may also influence its lipophilicity and biological activity. Typically, compounds like iodoethylspiperone are evaluated for their potential therapeutic effects, side effects, and mechanisms of action in various biological systems. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in radiolabeling studies due to the presence of iodine, which can be used in imaging applications. Overall, iodoethylspiperone serves as an important compound in the exploration of dopamine-related pathways and their implications in mental health.
Formula:C25H29FIN3O2
InChI:InChI=1/C25H29FIN3O2/c26-21-10-8-20(9-11-21)23(31)7-4-15-28-16-12-25(13-17-28)24(32)29(18-14-27)19-30(25)22-5-2-1-3-6-22/h1-3,5-6,8-11H,4,7,12-19H2
SMILES:c1ccc(cc1)N1CN(CCI)C(=O)C21CCN(CCCC(=O)c1ccc(cc1)F)CC2
Synonyms:- 125I-Ies
- 8-(4-(4-Fluorophenyl)-4-oxobutyl)-1-phenyl-3-(2-iodoethyl)-1,3,8-triazaspiro(4,5)decan-4-one
- 8-(4-(4-Fluorophenyl)-4-oxobutyl)-3-(2-(iodo-125I)ethyl)-1-phenyl-1,3,8-triazaspiro(4.5)decan-4-one
- 1,3,8-Triazaspiro(4.5)decan-4-one, 8-(4-(4-fluorophenyl)-4-oxobutyl)-3-(2-(iodo-125I)ethyl)-1-phenyl-
- 8-[4-(4-Fluorophenyl)-4-Oxobutyl]-3-(2-Iodoethyl)-1-Phenyl-1,3,8-Triazaspiro[4.5]Decan-4-One
- Iodoethylspiperone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.