CymitQuimica logo

CAS 13049-16-6

:

1,3-Benzenedicarboxylic acid, 2-chloro-

Description:
1,3-Benzenedicarboxylic acid, 2-chloro- is an aromatic compound characterized by the presence of two carboxylic acid groups (-COOH) and a chlorine substituent on a benzene ring. This compound features a symmetrical structure with the carboxylic acid groups located at the 1 and 3 positions relative to each other, while the chlorine atom is positioned at the 2 position. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid groups. The compound is likely to participate in various chemical reactions, including esterification and nucleophilic substitution, owing to its functional groups. Additionally, it may have applications in organic synthesis and materials science, particularly in the development of polymers or as an intermediate in the synthesis of other chemical compounds. Safety data should be consulted for handling and potential hazards, as chlorine-containing compounds can pose health risks.
Formula:C8H5ClO4
InChI:InChI=1S/C8H5ClO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:NJKVZDOEWYNQIO-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)C(=O)O)Cl)C(=O)O
Found 4 products.